C20H28O5S — CID 102189637
(5R)-2-(benzenesulfonyl)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyloct-7-en-3-one (PubChem CID 102189637) has the molecular formula C20H28O5S and a molecular weight of 380.51 g/mol. Its IUPAC name is (5R)-2-(benzenesulfonyl)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyloct-7-en-3-one.
| Compound Name | (5R)-2-(benzenesulfonyl)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyloct-7-en-3-one |
|---|---|
| PubChem CID | 102189637 |
| Molecular Formula | C20H28O5S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (5R)-2-(benzenesulfonyl)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyloct-7-en-3-one |
| SMILES | C=CC[C@@H](C)CC(=O)C(C[C@@H]1COC(C)(C)O1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H28O5S/c1-5-9-15(2)12-18(21)19(13-16-14-24-20(3,4)25-16)26(22,23)17-10-7-6-8-11-17/h5-8,10-11,15-16,19H,1,9,12-14H2,2-4H3/t15-,16-,19?/m1/s1 |
| InChIKey | HWIRHVDDROKYNQ-QNRNLVPOSA-N |
| XLogP | 3.54 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|