C16H21FO3S — CID 143726041
S-phenyl 2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-fluorobutanethioate (PubChem CID 143726041) has the molecular formula C16H21FO3S and a molecular weight of 312.41 g/mol. Its IUPAC name is S-phenyl 2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-fluorobutanethioate.
| Compound Name | S-phenyl 2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-fluorobutanethioate |
|---|---|
| PubChem CID | 143726041 |
| Molecular Formula | C16H21FO3S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | S-phenyl 2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-fluorobutanethioate |
| SMILES | CC1(C)OC[C@H](CC(CCF)C(=O)Sc2ccccc2)O1 |
| InChI | InChI=1S/C16H21FO3S/c1-16(2)19-11-13(20-16)10-12(8-9-17)15(18)21-14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3/t12?,13-/m0/s1 |
| InChIKey | NJYZLEUDKRAHOQ-ABLWVSNPSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|