C14H18O3S — CID 11173158
3-[(4R,5R)-2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl]propanal (PubChem CID 11173158) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is 3-[(4R,5R)-2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl]propanal.
| Compound Name | 3-[(4R,5R)-2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl]propanal |
|---|---|
| PubChem CID | 11173158 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 3-[(4R,5R)-2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl]propanal |
| SMILES | CC1(C)O[C@H](Sc2ccccc2)[C@@H](CCC=O)O1 |
| InChI | InChI=1S/C14H18O3S/c1-14(2)16-12(9-6-10-15)13(17-14)18-11-7-4-3-5-8-11/h3-5,7-8,10,12-13H,6,9H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | UAOQSAICRWDXSP-CHWSQXEVSA-N |
| XLogP | 3.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|