C16H22O3S — CID 101492879
S-phenyl 3-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)propanethioate (PubChem CID 101492879) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is S-phenyl 3-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)propanethioate.
| Compound Name | S-phenyl 3-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)propanethioate |
|---|---|
| PubChem CID | 101492879 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | S-phenyl 3-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)propanethioate |
| SMILES | CC1(C)OC(CCC(=O)Sc2ccccc2)C(C)(C)O1 |
| InChI | InChI=1S/C16H22O3S/c1-15(2)13(18-16(3,4)19-15)10-11-14(17)20-12-8-6-5-7-9-12/h5-9,13H,10-11H2,1-4H3 |
| InChIKey | LSBIOBABYLVVQV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|