C13H16O3S — CID 12617278
S-phenyl 3-(2-methyl-1,3-dioxolan-2-yl)propanethioate (PubChem CID 12617278) has the molecular formula C13H16O3S and a molecular weight of 252.33 g/mol. Its IUPAC name is S-phenyl 3-(2-methyl-1,3-dioxolan-2-yl)propanethioate.
| Compound Name | S-phenyl 3-(2-methyl-1,3-dioxolan-2-yl)propanethioate |
|---|---|
| PubChem CID | 12617278 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | S-phenyl 3-(2-methyl-1,3-dioxolan-2-yl)propanethioate |
| SMILES | CC1(CCC(=O)Sc2ccccc2)OCCO1 |
| InChI | InChI=1S/C13H16O3S/c1-13(15-9-10-16-13)8-7-12(14)17-11-5-3-2-4-6-11/h2-6H,7-10H2,1H3 |
| InChIKey | SXBLWDXJBIZOQH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|