C13H14O2S — CID 13479854
8-phenylsulfanyl-1,4-dioxaspiro[4.4]non-7-ene (PubChem CID 13479854) has the molecular formula C13H14O2S and a molecular weight of 234.32 g/mol. Its IUPAC name is 8-phenylsulfanyl-1,4-dioxaspiro[4.4]non-7-ene.
| Compound Name | 8-phenylsulfanyl-1,4-dioxaspiro[4.4]non-7-ene |
|---|---|
| PubChem CID | 13479854 |
| Molecular Formula | C13H14O2S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 8-phenylsulfanyl-1,4-dioxaspiro[4.4]non-7-ene |
| SMILES | C1=C(Sc2ccccc2)CC2(C1)OCCO2 |
| InChI | InChI=1S/C13H14O2S/c1-2-4-11(5-3-1)16-12-6-7-13(10-12)14-8-9-15-13/h1-6H,7-10H2 |
| InChIKey | YGANSHMKYAQGMY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |