C15H18O3S — CID 14616955
4-[2-[(E)-2-phenylsulfanylethenyl]-1,3-dioxolan-2-yl]butanal (PubChem CID 14616955) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is 4-[2-[(E)-2-phenylsulfanylethenyl]-1,3-dioxolan-2-yl]butanal.
| Compound Name | 4-[2-[(E)-2-phenylsulfanylethenyl]-1,3-dioxolan-2-yl]butanal |
|---|---|
| PubChem CID | 14616955 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 4-[2-[(E)-2-phenylsulfanylethenyl]-1,3-dioxolan-2-yl]butanal |
| SMILES | O=CCCCC1(/C=C/Sc2ccccc2)OCCO1 |
| InChI | InChI=1S/C15H18O3S/c16-10-5-4-8-15(17-11-12-18-15)9-13-19-14-6-2-1-3-7-14/h1-3,6-7,9-10,13H,4-5,8,11-12H2/b13-9+ |
| InChIKey | QBNIVIWFJORXPZ-UKTHLTGXSA-N |
| XLogP | 3.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|