C14H14O3S — CID 101098845
(6S)-6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one (PubChem CID 101098845) has the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is (6S)-6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one.
| Compound Name | (6S)-6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one |
|---|---|
| PubChem CID | 101098845 |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | (6S)-6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-one |
| SMILES | O=C1C=CC2(OCCO2)[C@@H](Sc2ccccc2)C1 |
| InChI | InChI=1S/C14H14O3S/c15-11-6-7-14(16-8-9-17-14)13(10-11)18-12-4-2-1-3-5-12/h1-7,13H,8-10H2/t13-/m0/s1 |
| InChIKey | UCZZXVCKCKYUEN-ZDUSSCGKSA-N |
| XLogP | 2.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |