C14H18O5S — CID 132537625
3-[2-[2-(benzenesulfonyl)ethyl]-1,3-dioxolan-2-yl]propanal (PubChem CID 132537625) has the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. Its IUPAC name is 3-[2-[2-(benzenesulfonyl)ethyl]-1,3-dioxolan-2-yl]propanal.
| Compound Name | 3-[2-[2-(benzenesulfonyl)ethyl]-1,3-dioxolan-2-yl]propanal |
|---|---|
| PubChem CID | 132537625 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 3-[2-[2-(benzenesulfonyl)ethyl]-1,3-dioxolan-2-yl]propanal |
| SMILES | O=CCCC1(CCS(=O)(=O)c2ccccc2)OCCO1 |
| InChI | InChI=1S/C14H18O5S/c15-9-4-7-14(18-10-11-19-14)8-12-20(16,17)13-5-2-1-3-6-13/h1-3,5-6,9H,4,7-8,10-12H2 |
| InChIKey | CXMRZRABTUEWKE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|