C12H15LiO4S — CID 134874876
lithium 2-[2-(benzenesulfonyl)ethyl]-2-methyl-1,3-dioxolane (PubChem CID 134874876) has the molecular formula C12H15LiO4S and a molecular weight of 262.26 g/mol. Its IUPAC name is lithium 2-[2-(benzenesulfonyl)ethyl]-2-methyl-1,3-dioxolane.
| Compound Name | lithium 2-[2-(benzenesulfonyl)ethyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 134874876 |
| Molecular Formula | C12H15LiO4S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | lithium 2-[2-(benzenesulfonyl)ethyl]-2-methyl-1,3-dioxolane |
| SMILES | CC1(C[CH-]S(=O)(=O)c2ccccc2)OCCO1.[Li+] |
| InChI | InChI=1S/C12H15O4S.Li/c1-12(15-8-9-16-12)7-10-17(13,14)11-5-3-2-4-6-11;/h2-6,10H,7-9H2,1H3;/q-1;+1 |
| InChIKey | HPJJPBFEABFXIW-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|