C19H24O4S — CID 11336994
2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylsulfanylmethyl]cycloheptane-1,3-dione (PubChem CID 11336994) has the molecular formula C19H24O4S and a molecular weight of 348.46 g/mol. Its IUPAC name is 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylsulfanylmethyl]cycloheptane-1,3-dione.
| Compound Name | 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylsulfanylmethyl]cycloheptane-1,3-dione |
|---|---|
| PubChem CID | 11336994 |
| Molecular Formula | C19H24O4S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylsulfanylmethyl]cycloheptane-1,3-dione |
| SMILES | CC1(C)OC[C@H](C(Sc2ccccc2)C2C(=O)CCCCC2=O)O1 |
| InChI | InChI=1S/C19H24O4S/c1-19(2)22-12-16(23-19)18(24-13-8-4-3-5-9-13)17-14(20)10-6-7-11-15(17)21/h3-5,8-9,16-18H,6-7,10-12H2,1-2H3/t16-,18?/m1/s1 |
| InChIKey | LFVUAHLBIFZMBT-PYUWXLGESA-N |
| XLogP | 3.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|