C22H30O6S — CID 71578776
(E,6R)-9-(benzenesulfonyl)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methyldec-3-ene-2,8-dione (PubChem CID 71578776) has the molecular formula C22H30O6S and a molecular weight of 422.54 g/mol. Its IUPAC name is (E,6R)-9-(benzenesulfonyl)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methyldec-3-ene-2,8-dione.
| Compound Name | (E,6R)-9-(benzenesulfonyl)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methyldec-3-ene-2,8-dione |
|---|---|
| PubChem CID | 71578776 |
| Molecular Formula | C22H30O6S |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (E,6R)-9-(benzenesulfonyl)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-methyldec-3-ene-2,8-dione |
| SMILES | CC(=O)/C=C/C[C@@H](C)CC(=O)C(C[C@@H]1COC(C)(C)O1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H30O6S/c1-16(9-8-10-17(2)23)13-20(24)21(14-18-15-27-22(3,4)28-18)29(25,26)19-11-6-5-7-12-19/h5-8,10-12,16,18,21H,9,13-15H2,1-4H3/b10-8+/t16-,18-,21?/m1/s1 |
| InChIKey | DOEKBWDFRUPNOL-LHEJLWFQSA-N |
| XLogP | 3.50 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|