C19H26O5S — CID 117069625
2-(benzenesulfonyl)-4,4-dimethyl-1-(2-methyl-1,3-dioxolan-2-yl)hept-6-en-3-one (PubChem CID 117069625) has the molecular formula C19H26O5S and a molecular weight of 366.48 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-4,4-dimethyl-1-(2-methyl-1,3-dioxolan-2-yl)hept-6-en-3-one.
| Compound Name | 2-(benzenesulfonyl)-4,4-dimethyl-1-(2-methyl-1,3-dioxolan-2-yl)hept-6-en-3-one |
|---|---|
| PubChem CID | 117069625 |
| Molecular Formula | C19H26O5S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-(benzenesulfonyl)-4,4-dimethyl-1-(2-methyl-1,3-dioxolan-2-yl)hept-6-en-3-one |
| SMILES | C=CCC(C)(C)C(=O)C(CC1(C)OCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26O5S/c1-5-11-18(2,3)17(20)16(14-19(4)23-12-13-24-19)25(21,22)15-9-7-6-8-10-15/h5-10,16H,1,11-14H2,2-4H3 |
| InChIKey | QWXDIOHCEZLHCD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|