C18H26O5S — CID 135050251
2-(benzenesulfonyl)-1-(1,3-dioxolan-2-yl)nonan-3-one (PubChem CID 135050251) has the molecular formula C18H26O5S and a molecular weight of 354.47 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-(1,3-dioxolan-2-yl)nonan-3-one.
| Compound Name | 2-(benzenesulfonyl)-1-(1,3-dioxolan-2-yl)nonan-3-one |
|---|---|
| PubChem CID | 135050251 |
| Molecular Formula | C18H26O5S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-(benzenesulfonyl)-1-(1,3-dioxolan-2-yl)nonan-3-one |
| SMILES | CCCCCCC(=O)C(CC1OCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26O5S/c1-2-3-4-8-11-16(19)17(14-18-22-12-13-23-18)24(20,21)15-9-6-5-7-10-15/h5-7,9-10,17-18H,2-4,8,11-14H2,1H3 |
| InChIKey | UNFCIEQEYMNOLJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|