C16H20O5S — CID 86052393
7-[2-(benzenesulfonyl)ethyl]-1,4-dioxaspiro[4.5]decan-8-one (PubChem CID 86052393) has the molecular formula C16H20O5S and a molecular weight of 324.40 g/mol. Its IUPAC name is 7-[2-(benzenesulfonyl)ethyl]-1,4-dioxaspiro[4.5]decan-8-one.
| Compound Name | 7-[2-(benzenesulfonyl)ethyl]-1,4-dioxaspiro[4.5]decan-8-one |
|---|---|
| PubChem CID | 86052393 |
| Molecular Formula | C16H20O5S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 7-[2-(benzenesulfonyl)ethyl]-1,4-dioxaspiro[4.5]decan-8-one |
| SMILES | O=C1CCC2(CC1CCS(=O)(=O)c1ccccc1)OCCO2 |
| InChI | InChI=1S/C16H20O5S/c17-15-6-8-16(20-9-10-21-16)12-13(15)7-11-22(18,19)14-4-2-1-3-5-14/h1-5,13H,6-12H2 |
| InChIKey | FEXSQVHZLTUIJQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |