C23H34O7S — CID 11155262
(2S,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-2-methoxy-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-3-one (PubChem CID 11155262) has the molecular formula C23H34O7S and a molecular weight of 454.59 g/mol. Its IUPAC name is (2S,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-2-methoxy-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-3-one.
| Compound Name | (2S,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-2-methoxy-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-3-one |
|---|---|
| PubChem CID | 11155262 |
| Molecular Formula | C23H34O7S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (2S,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-2-methoxy-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-3-one |
| SMILES | CO[C@@]1(C(C)(C)CS(=O)(=O)c2ccccc2)O[C@H](C[C@H]2OC(C)(C)O[C@@H]2C)CCC1=O |
| InChI | InChI=1S/C23H34O7S/c1-16-19(30-22(4,5)28-16)14-17-12-13-20(24)23(27-6,29-17)21(2,3)15-31(25,26)18-10-8-7-9-11-18/h7-11,16-17,19H,12-15H2,1-6H3/t16-,17+,19-,23-/m1/s1 |
| InChIKey | JHAIEUXPUZBMSG-PDPLOHQNSA-N |
| XLogP | 3.51 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |