C25H32O7S — CID 11005288
(1'S,5'S)-7'-(benzenesulfonyl)-3',3',11',14',14'-pentamethylspiro[1,3-dioxolane-2,9'-2,4-dioxatricyclo[8.3.1.01,5]tetradec-10-ene]-8'-one (PubChem CID 11005288) has the molecular formula C25H32O7S and a molecular weight of 476.59 g/mol. Its IUPAC name is (1'S,5'S)-7'-(benzenesulfonyl)-3',3',11',14',14'-pentamethylspiro[1,3-dioxolane-2,9'-2,4-dioxatricyclo[8.3.1.01,5]tetradec-10-ene]-8'-one.
| Compound Name | (1'S,5'S)-7'-(benzenesulfonyl)-3',3',11',14',14'-pentamethylspiro[1,3-dioxolane-2,9'-2,4-dioxatricyclo[8.3.1.01,5]tetradec-10-ene]-8'-one |
|---|---|
| PubChem CID | 11005288 |
| Molecular Formula | C25H32O7S |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (1'S,5'S)-7'-(benzenesulfonyl)-3',3',11',14',14'-pentamethylspiro[1,3-dioxolane-2,9'-2,4-dioxatricyclo[8.3.1.01,5]tetradec-10-ene]-8'-one |
| SMILES | CC1=C2C3(OCCO3)C(=O)C(S(=O)(=O)c3ccccc3)C[C@@H]3OC(C)(C)O[C@@]3(CC1)C2(C)C |
| InChI | InChI=1S/C25H32O7S/c1-16-11-12-24-19(31-23(4,5)32-24)15-18(33(27,28)17-9-7-6-8-10-17)21(26)25(29-13-14-30-25)20(16)22(24,2)3/h6-10,18-19H,11-15H2,1-5H3/t18?,19-,24+/m0/s1 |
| InChIKey | RPQYFUFSPUZOQY-OZOSHOQESA-N |
| XLogP | 3.57 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|