C25H34O7S — CID 10950911
2-[(4S,5S)-4-[2-(benzenesulfonyl)ethyl]-2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-en-7-yl]-1,3-dioxolane-2-carbaldehyde (PubChem CID 10950911) has the molecular formula C25H34O7S and a molecular weight of 478.61 g/mol. Its IUPAC name is 2-[(4S,5S)-4-[2-(benzenesulfonyl)ethyl]-2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-en-7-yl]-1,3-dioxolane-2-carbaldehyde.
| Compound Name | 2-[(4S,5S)-4-[2-(benzenesulfonyl)ethyl]-2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-en-7-yl]-1,3-dioxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 10950911 |
| Molecular Formula | C25H34O7S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 2-[(4S,5S)-4-[2-(benzenesulfonyl)ethyl]-2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-en-7-yl]-1,3-dioxolane-2-carbaldehyde |
| SMILES | CC1=C(C2(C=O)OCCO2)C(C)(C)[C@]2(CC1)OC(C)(C)O[C@H]2CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H34O7S/c1-18-11-13-24(22(2,3)21(18)25(17-26)29-14-15-30-25)20(31-23(4,5)32-24)12-16-33(27,28)19-9-7-6-8-10-19/h6-10,17,20H,11-16H2,1-5H3/t20-,24+/m0/s1 |
| InChIKey | MYVCLUJXRAZNDU-GBXCKJPGSA-N |
| XLogP | 3.82 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|