C14H16O5S — CID 14937423
4-(benzenesulfonyl)-1,10-dioxaspiro[4.5]decan-6-one (PubChem CID 14937423) has the molecular formula C14H16O5S and a molecular weight of 296.34 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-1,10-dioxaspiro[4.5]decan-6-one.
| Compound Name | 4-(benzenesulfonyl)-1,10-dioxaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 14937423 |
| Molecular Formula | C14H16O5S |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-(benzenesulfonyl)-1,10-dioxaspiro[4.5]decan-6-one |
| SMILES | O=C1CCCOC12OCCC2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16O5S/c15-12-7-4-9-18-14(12)13(8-10-19-14)20(16,17)11-5-2-1-3-6-11/h1-3,5-6,13H,4,7-10H2 |
| InChIKey | LNFQQKKUAMTKTR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |