C14H18O4S — CID 15062011
(4S)-4-(benzenesulfonyl)-1,10-dioxaspiro[4.5]decane (PubChem CID 15062011) has the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. Its IUPAC name is (4S)-4-(benzenesulfonyl)-1,10-dioxaspiro[4.5]decane.
| Compound Name | (4S)-4-(benzenesulfonyl)-1,10-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 15062011 |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (4S)-4-(benzenesulfonyl)-1,10-dioxaspiro[4.5]decane |
| SMILES | O=S(=O)(c1ccccc1)[C@H]1CCOC12CCCCO2 |
| InChI | InChI=1S/C14H18O4S/c15-19(16,12-6-2-1-3-7-12)13-8-11-18-14(13)9-4-5-10-17-14/h1-3,6-7,13H,4-5,8-11H2/t13-,14?/m0/s1 |
| InChIKey | MCWLIYQEEWORNI-LSLKUGRBSA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |