C15H18O5S — CID 10979820
(4S,5R)-4-(benzenesulfonyl)-2-methyl-1,10-dioxaspiro[4.5]decan-6-one (PubChem CID 10979820) has the molecular formula C15H18O5S and a molecular weight of 310.37 g/mol. Its IUPAC name is (4S,5R)-4-(benzenesulfonyl)-2-methyl-1,10-dioxaspiro[4.5]decan-6-one.
| Compound Name | (4S,5R)-4-(benzenesulfonyl)-2-methyl-1,10-dioxaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 10979820 |
| Molecular Formula | C15H18O5S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (4S,5R)-4-(benzenesulfonyl)-2-methyl-1,10-dioxaspiro[4.5]decan-6-one |
| SMILES | CC1C[C@H](S(=O)(=O)c2ccccc2)[C@]2(OCCCC2=O)O1 |
| InChI | InChI=1S/C15H18O5S/c1-11-10-14(15(20-11)13(16)8-5-9-19-15)21(17,18)12-6-3-2-4-7-12/h2-4,6-7,11,14H,5,8-10H2,1H3/t11?,14-,15+/m0/s1 |
| InChIKey | ALQALZSVTAAXMI-YUIIUQSRSA-N |
| XLogP | 1.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |