C17H20O5S — CID 134877797
(6S,6aR)-1-(benzenesulfonyl)-6-(ethoxymethoxy)-4,5,6,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 134877797) has the molecular formula C17H20O5S and a molecular weight of 336.41 g/mol. Its IUPAC name is (6S,6aR)-1-(benzenesulfonyl)-6-(ethoxymethoxy)-4,5,6,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | (6S,6aR)-1-(benzenesulfonyl)-6-(ethoxymethoxy)-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 134877797 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (6S,6aR)-1-(benzenesulfonyl)-6-(ethoxymethoxy)-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | CCOCO[C@H]1CCC2=CC(=O)C(S(=O)(=O)c3ccccc3)[C@H]21 |
| InChI | InChI=1S/C17H20O5S/c1-2-21-11-22-15-9-8-12-10-14(18)17(16(12)15)23(19,20)13-6-4-3-5-7-13/h3-7,10,15-17H,2,8-9,11H2,1H3/t15-,16+,17?/m0/s1 |
| InChIKey | JOEKITQJPXANLT-RTKIROINSA-N |
| XLogP | 2.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|