C17H22O8S — CID 57313007
1-[(4S,4aR,8aR)-2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione (PubChem CID 57313007) has the molecular formula C17H22O8S and a molecular weight of 386.42 g/mol. Its IUPAC name is 1-[(4S,4aR,8aR)-2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione.
| Compound Name | 1-[(4S,4aR,8aR)-2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 57313007 |
| Molecular Formula | C17H22O8S |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-[(4S,4aR,8aR)-2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione |
| SMILES | Cc1ccc(S(O)(O)C(=O)C(=O)[C@H]2OC(C)O[C@@H]3COC(C)O[C@@H]23)cc1 |
| InChI | InChI=1S/C17H22O8S/c1-9-4-6-12(7-5-9)26(20,21)17(19)14(18)16-15-13(23-11(3)25-16)8-22-10(2)24-15/h4-7,10-11,13,15-16,20-21H,8H2,1-3H3/t10?,11?,13-,15-,16-/m1/s1 |
| InChIKey | ZNJCECFZMKIKQH-MFZPGYNTSA-N |
| XLogP | 2.09 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|