C19H22O14S — CID 57070007
[(3S,4S)-3,4-diacetyloxy-6-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]-1,3,4-trihydroxy-2,5,6-trioxohexyl] acetate (PubChem CID 57070007) has the molecular formula C19H22O14S and a molecular weight of 506.44 g/mol. Its IUPAC name is [(3S,4S)-3,4-diacetyloxy-6-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]-1,3,4-trihydroxy-2,5,6-trioxohexyl] acetate.
| Compound Name | [(3S,4S)-3,4-diacetyloxy-6-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]-1,3,4-trihydroxy-2,5,6-trioxohexyl] acetate |
|---|---|
| PubChem CID | 57070007 |
| Molecular Formula | C19H22O14S |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | [(3S,4S)-3,4-diacetyloxy-6-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]-1,3,4-trihydroxy-2,5,6-trioxohexyl] acetate |
| SMILES | CC(=O)OC(O)C(=O)[C@](O)(OC(C)=O)[C@@](O)(OC(C)=O)C(=O)C(=O)S(O)(O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H22O14S/c1-9-5-7-13(8-6-9)34(29,30)17(26)15(24)19(28,33-12(4)22)18(27,32-11(3)21)14(23)16(25)31-10(2)20/h5-8,16,25,27-30H,1-4H3/t16?,18-,19-/m0/s1 |
| InChIKey | PVILIDVMRYLGCV-MSYFUGIWSA-N |
| XLogP | -0.85 |
| TPSA | 231.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|