C17H22O8S — CID 10883560
[2-(2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)-2-oxoethyl] 4-methylbenzenesulfonate (PubChem CID 10883560) has the molecular formula C17H22O8S and a molecular weight of 386.42 g/mol. Its IUPAC name is [2-(2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)-2-oxoethyl] 4-methylbenzenesulfonate.
| Compound Name | [2-(2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)-2-oxoethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10883560 |
| Molecular Formula | C17H22O8S |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [2-(2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)-2-oxoethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(=O)C2OC(C)OC3COC(C)OC32)cc1 |
| InChI | InChI=1S/C17H22O8S/c1-10-4-6-13(7-5-10)26(19,20)22-8-14(18)16-17-15(23-12(3)25-16)9-21-11(2)24-17/h4-7,11-12,15-17H,8-9H2,1-3H3 |
| InChIKey | DTOALNKNMCJDOD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|