C17H24O8S — CID 134880025
[2-[5-(dimethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] 4-methylbenzenesulfonate (PubChem CID 134880025) has the molecular formula C17H24O8S and a molecular weight of 388.44 g/mol. Its IUPAC name is [2-[5-(dimethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[5-(dimethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134880025 |
| Molecular Formula | C17H24O8S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [2-[5-(dimethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl] 4-methylbenzenesulfonate |
| SMILES | COC(OC)C1OC(C)(C)OC1C(=O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24O8S/c1-11-6-8-12(9-7-11)26(19,20)23-10-13(18)14-15(16(21-4)22-5)25-17(2,3)24-14/h6-9,14-16H,10H2,1-5H3 |
| InChIKey | WFADMPRQYUVCBO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|