C16H20O6S — CID 134878050
[(1R,5R,7S)-5-ethyl-2-oxo-6,8-dioxabicyclo[3.2.1]octan-7-yl]methyl 4-methylbenzenesulfonate (PubChem CID 134878050) has the molecular formula C16H20O6S and a molecular weight of 340.40 g/mol. Its IUPAC name is [(1R,5R,7S)-5-ethyl-2-oxo-6,8-dioxabicyclo[3.2.1]octan-7-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,5R,7S)-5-ethyl-2-oxo-6,8-dioxabicyclo[3.2.1]octan-7-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134878050 |
| Molecular Formula | C16H20O6S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | [(1R,5R,7S)-5-ethyl-2-oxo-6,8-dioxabicyclo[3.2.1]octan-7-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CC[C@]12CCC(=O)[C@H](O1)[C@H](COS(=O)(=O)c1ccc(C)cc1)O2 |
| InChI | InChI=1S/C16H20O6S/c1-3-16-9-8-13(17)15(22-16)14(21-16)10-20-23(18,19)12-6-4-11(2)5-7-12/h4-7,14-15H,3,8-10H2,1-2H3/t14-,15-,16+/m0/s1 |
| InChIKey | KGZFMWSGBYXWLO-HRCADAONSA-N |
| XLogP | 1.95 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|