C18H26O7S — CID 10068733
tert-butyl 2-[6-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxan-4-yl]acetate (PubChem CID 10068733) has the molecular formula C18H26O7S and a molecular weight of 386.47 g/mol. Its IUPAC name is tert-butyl 2-[6-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[6-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 10068733 |
| Molecular Formula | C18H26O7S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | tert-butyl 2-[6-[(4-methylphenyl)sulfonyloxymethyl]-1,3-dioxan-4-yl]acetate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC(CC(=O)OC(C)(C)C)OCO2)cc1 |
| InChI | InChI=1S/C18H26O7S/c1-13-5-7-16(8-6-13)26(20,21)24-11-15-9-14(22-12-23-15)10-17(19)25-18(2,3)4/h5-8,14-15H,9-12H2,1-4H3 |
| InChIKey | XZWVOHWYLKOXCW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|