C23H28O11S — CID 134841410
[4,5-diacetyloxy-6-but-3-ynoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate (PubChem CID 134841410) has the molecular formula C23H28O11S and a molecular weight of 512.53 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-but-3-ynoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate.
| Compound Name | [4,5-diacetyloxy-6-but-3-ynoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 134841410 |
| Molecular Formula | C23H28O11S |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | [4,5-diacetyloxy-6-but-3-ynoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
| SMILES | C#CCCOC1OC(COS(=O)(=O)c2ccc(C)cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C23H28O11S/c1-6-7-12-29-23-22(33-17(5)26)21(32-16(4)25)20(31-15(3)24)19(34-23)13-30-35(27,28)18-10-8-14(2)9-11-18/h1,8-11,19-23H,7,12-13H2,2-5H3 |
| InChIKey | PAOWAUUTXOWZKS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|