C16H22O8S — CID 14999912
[(4aR,6S,7S,8R,8aR)-6,7-dihydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate (PubChem CID 14999912) has the molecular formula C16H22O8S and a molecular weight of 374.41 g/mol. Its IUPAC name is [(4aR,6S,7S,8R,8aR)-6,7-dihydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate.
| Compound Name | [(4aR,6S,7S,8R,8aR)-6,7-dihydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14999912 |
| Molecular Formula | C16H22O8S |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | [(4aR,6S,7S,8R,8aR)-6,7-dihydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@H](O)[C@@H](O)O[C@@H]3COC(C)(C)O[C@@H]23)cc1 |
| InChI | InChI=1S/C16H22O8S/c1-9-4-6-10(7-5-9)25(19,20)24-14-12(17)15(18)22-11-8-21-16(2,3)23-13(11)14/h4-7,11-15,17-18H,8H2,1-3H3/t11-,12+,13-,14-,15+/m1/s1 |
| InChIKey | UYUZOMPIYANIAB-KHMAMNHCSA-N |
| XLogP | 0.30 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|