C23H34O8S — CID 90932335
1-[(3aS,4S,6S,6aR)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione (PubChem CID 90932335) has the molecular formula C23H34O8S and a molecular weight of 470.58 g/mol. Its IUPAC name is 1-[(3aS,4S,6S,6aR)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione.
| Compound Name | 1-[(3aS,4S,6S,6aR)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 90932335 |
| Molecular Formula | C23H34O8S |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 1-[(3aS,4S,6S,6aR)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione |
| SMILES | CCCCCCCO[C@H]1O[C@H](C(=O)C(=O)S(O)(O)c2ccc(C)cc2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C23H34O8S/c1-5-6-7-8-9-14-28-22-20-19(30-23(3,4)31-20)18(29-22)17(24)21(25)32(26,27)16-12-10-15(2)11-13-16/h10-13,18-20,22,26-27H,5-9,14H2,1-4H3/t18-,19+,20+,22+/m1/s1 |
| InChIKey | OGVWKJBTOOAOQX-AQCRLBJHSA-N |
| XLogP | 4.43 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|