C17H20O5S — CID 164935211
(3aR,4S)-6-methoxy-2,2-dimethyl-4'-phenylsulfanylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-one (PubChem CID 164935211) has the molecular formula C17H20O5S and a molecular weight of 336.41 g/mol. Its IUPAC name is (3aR,4S)-6-methoxy-2,2-dimethyl-4'-phenylsulfanylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-one.
| Compound Name | (3aR,4S)-6-methoxy-2,2-dimethyl-4'-phenylsulfanylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-one |
|---|---|
| PubChem CID | 164935211 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (3aR,4S)-6-methoxy-2,2-dimethyl-4'-phenylsulfanylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-one |
| SMILES | COC1O[C@@]2(CC(Sc3ccccc3)C2=O)[C@@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C17H20O5S/c1-16(2)20-12-14(21-16)17(22-15(12)19-3)9-11(13(17)18)23-10-7-5-4-6-8-10/h4-8,11-12,14-15H,9H2,1-3H3/t11?,12?,14-,15?,17-/m1/s1 |
| InChIKey | CFOIGAJAUZSZRM-DEQZWRFESA-N |
| XLogP | 2.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |