C25H32O11S — CID 11124395
ethyl (2R,3R,3aS,5S,6aR)-3-acetyloxy-5-[(1R)-1-acetyloxy-2-ethoxy-2-oxoethyl]-2-ethoxy-6-phenylsulfanyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate (PubChem CID 11124395) has the molecular formula C25H32O11S and a molecular weight of 540.59 g/mol. Its IUPAC name is ethyl (2R,3R,3aS,5S,6aR)-3-acetyloxy-5-[(1R)-1-acetyloxy-2-ethoxy-2-oxoethyl]-2-ethoxy-6-phenylsulfanyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate.
| Compound Name | ethyl (2R,3R,3aS,5S,6aR)-3-acetyloxy-5-[(1R)-1-acetyloxy-2-ethoxy-2-oxoethyl]-2-ethoxy-6-phenylsulfanyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate |
|---|---|
| PubChem CID | 11124395 |
| Molecular Formula | C25H32O11S |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | ethyl (2R,3R,3aS,5S,6aR)-3-acetyloxy-5-[(1R)-1-acetyloxy-2-ethoxy-2-oxoethyl]-2-ethoxy-6-phenylsulfanyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate |
| SMILES | CCOC(=O)[C@H](OC(C)=O)[C@@]1(C(=O)OCC)O[C@H]2[C@@H](OC(C)=O)[C@H](OCC)O[C@H]2C1Sc1ccccc1 |
| InChI | InChI=1S/C25H32O11S/c1-6-30-22(28)20(34-15(5)27)25(24(29)32-8-3)21(37-16-12-10-9-11-13-16)18-17(36-25)19(33-14(4)26)23(35-18)31-7-2/h9-13,17-21,23H,6-8H2,1-5H3/t17-,18-,19-,20+,21?,23-,25-/m1/s1 |
| InChIKey | CMZSHOVOZIUQSN-RPTJUBCBSA-N |
| XLogP | 2.04 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|