C21H28O4S — CID 10547564
(3R,3aR,4S,6aR)-3-methyl-4-octyl-3-phenylsulfanyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione (PubChem CID 10547564) has the molecular formula C21H28O4S and a molecular weight of 376.52 g/mol. Its IUPAC name is (3R,3aR,4S,6aR)-3-methyl-4-octyl-3-phenylsulfanyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione.
| Compound Name | (3R,3aR,4S,6aR)-3-methyl-4-octyl-3-phenylsulfanyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione |
|---|---|
| PubChem CID | 10547564 |
| Molecular Formula | C21H28O4S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (3R,3aR,4S,6aR)-3-methyl-4-octyl-3-phenylsulfanyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione |
| SMILES | CCCCCCCC[C@@H]1OC(=O)[C@@H]2OC(=O)[C@](C)(Sc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C21H28O4S/c1-3-4-5-6-7-11-14-16-17-18(19(22)24-16)25-20(23)21(17,2)26-15-12-9-8-10-13-15/h8-10,12-13,16-18H,3-7,11,14H2,1-2H3/t16-,17+,18+,21+/m0/s1 |
| InChIKey | GUTWJCRANMODNI-XKGFGPFHSA-N |
| XLogP | 4.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|