C15H16O4 — CID 91752690
(3aS,4S,6aS)-4-[2-(4-methylphenyl)ethyl]-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione (PubChem CID 91752690) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (3aS,4S,6aS)-4-[2-(4-methylphenyl)ethyl]-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione.
| Compound Name | (3aS,4S,6aS)-4-[2-(4-methylphenyl)ethyl]-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione |
|---|---|
| PubChem CID | 91752690 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (3aS,4S,6aS)-4-[2-(4-methylphenyl)ethyl]-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione |
| SMILES | Cc1ccc(CC[C@@H]2OC(=O)[C@H]3OC(=O)C[C@@H]23)cc1 |
| InChI | InChI=1S/C15H16O4/c1-9-2-4-10(5-3-9)6-7-12-11-8-13(16)19-14(11)15(17)18-12/h2-5,11-12,14H,6-8H2,1H3/t11-,12-,14-/m0/s1 |
| InChIKey | JKERMARNKVNMQC-OBJOEFQTSA-N |
| XLogP | 1.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |