C22H32O5S — CID 10597599
methyl (2R)-2-hydroxy-2-[(2S,3S,4R)-4-methyl-2-octyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate (PubChem CID 10597599) has the molecular formula C22H32O5S and a molecular weight of 408.56 g/mol. Its IUPAC name is methyl (2R)-2-hydroxy-2-[(2S,3S,4R)-4-methyl-2-octyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate.
| Compound Name | methyl (2R)-2-hydroxy-2-[(2S,3S,4R)-4-methyl-2-octyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
|---|---|
| PubChem CID | 10597599 |
| Molecular Formula | C22H32O5S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | methyl (2R)-2-hydroxy-2-[(2S,3S,4R)-4-methyl-2-octyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
| SMILES | CCCCCCCC[C@@H]1OC(=O)[C@](C)(Sc2ccccc2)[C@H]1[C@@H](O)C(=O)OC |
| InChI | InChI=1S/C22H32O5S/c1-4-5-6-7-8-12-15-17-18(19(23)20(24)26-3)22(2,21(25)27-17)28-16-13-10-9-11-14-16/h9-11,13-14,17-19,23H,4-8,12,15H2,1-3H3/t17-,18+,19+,22+/m0/s1 |
| InChIKey | FABAZHWYFODRAU-JZJXAQOMSA-N |
| XLogP | 4.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|