C23H30O10S — CID 10918079
ethyl (2R,3R,3aS,5S,6aR)-3-acetyloxy-2-ethoxy-5-[(1R)-2-ethoxy-1-hydroxy-2-oxoethyl]-6-phenylsulfanyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate (PubChem CID 10918079) has the molecular formula C23H30O10S and a molecular weight of 498.55 g/mol. Its IUPAC name is ethyl (2R,3R,3aS,5S,6aR)-3-acetyloxy-2-ethoxy-5-[(1R)-2-ethoxy-1-hydroxy-2-oxoethyl]-6-phenylsulfanyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate.
| Compound Name | ethyl (2R,3R,3aS,5S,6aR)-3-acetyloxy-2-ethoxy-5-[(1R)-2-ethoxy-1-hydroxy-2-oxoethyl]-6-phenylsulfanyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate |
|---|---|
| PubChem CID | 10918079 |
| Molecular Formula | C23H30O10S |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | ethyl (2R,3R,3aS,5S,6aR)-3-acetyloxy-2-ethoxy-5-[(1R)-2-ethoxy-1-hydroxy-2-oxoethyl]-6-phenylsulfanyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate |
| SMILES | CCOC(=O)[C@H](O)[C@@]1(C(=O)OCC)O[C@H]2[C@@H](OC(C)=O)[C@H](OCC)O[C@H]2C1Sc1ccccc1 |
| InChI | InChI=1S/C23H30O10S/c1-5-28-20(26)18(25)23(22(27)30-7-3)19(34-14-11-9-8-10-12-14)16-15(33-23)17(31-13(4)24)21(32-16)29-6-2/h8-12,15-19,21,25H,5-7H2,1-4H3/t15-,16-,17-,18+,19?,21-,23-/m1/s1 |
| InChIKey | TYEURRPXHTZWHH-CVSMTVBYSA-N |
| XLogP | 1.47 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|