C21H26O9S — CID 11048708
ethyl (2R,3R,3aS,5S,6aR)-2-ethoxy-5-(2-ethoxy-2-oxoacetyl)-3-hydroxy-6-phenylsulfanyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate (PubChem CID 11048708) has the molecular formula C21H26O9S and a molecular weight of 454.50 g/mol. Its IUPAC name is ethyl (2R,3R,3aS,5S,6aR)-2-ethoxy-5-(2-ethoxy-2-oxoacetyl)-3-hydroxy-6-phenylsulfanyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate.
| Compound Name | ethyl (2R,3R,3aS,5S,6aR)-2-ethoxy-5-(2-ethoxy-2-oxoacetyl)-3-hydroxy-6-phenylsulfanyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate |
|---|---|
| PubChem CID | 11048708 |
| Molecular Formula | C21H26O9S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | ethyl (2R,3R,3aS,5S,6aR)-2-ethoxy-5-(2-ethoxy-2-oxoacetyl)-3-hydroxy-6-phenylsulfanyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate |
| SMILES | CCOC(=O)C(=O)[C@@]1(C(=O)OCC)O[C@H]2[C@@H](O)[C@H](OCC)O[C@H]2C1Sc1ccccc1 |
| InChI | InChI=1S/C21H26O9S/c1-4-26-18(24)16(23)21(20(25)28-6-3)17(31-12-10-8-7-9-11-12)15-14(30-21)13(22)19(29-15)27-5-2/h7-11,13-15,17,19,22H,4-6H2,1-3H3/t13-,14+,15-,17?,19-,21-/m1/s1 |
| InChIKey | KHIZTPMFOVPUNB-JGDWXBAISA-N |
| XLogP | 1.10 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|