C22H28O8S — CID 101161232
ethyl (1S,2R,6R,8R,9S,10S)-10-(2-ethoxy-2-oxoethyl)-4,4-dimethyl-9-phenylsulfanyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate (PubChem CID 101161232) has the molecular formula C22H28O8S and a molecular weight of 452.53 g/mol. Its IUPAC name is ethyl (1S,2R,6R,8R,9S,10S)-10-(2-ethoxy-2-oxoethyl)-4,4-dimethyl-9-phenylsulfanyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate.
| Compound Name | ethyl (1S,2R,6R,8R,9S,10S)-10-(2-ethoxy-2-oxoethyl)-4,4-dimethyl-9-phenylsulfanyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate |
|---|---|
| PubChem CID | 101161232 |
| Molecular Formula | C22H28O8S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | ethyl (1S,2R,6R,8R,9S,10S)-10-(2-ethoxy-2-oxoethyl)-4,4-dimethyl-9-phenylsulfanyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate |
| SMILES | CCOC(=O)C[C@@]1(C(=O)OCC)O[C@@H]2[C@@H](O[C@@H]3OC(C)(C)O[C@@H]32)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C22H28O8S/c1-5-25-14(23)12-22(20(24)26-6-2)18(31-13-10-8-7-9-11-13)16-15(29-22)17-19(27-16)30-21(3,4)28-17/h7-11,15-19H,5-6,12H2,1-4H3/t15-,16-,17-,18+,19-,22-/m1/s1 |
| InChIKey | ZKTMBOFGXDLJOD-XAUGGJLPSA-N |
| XLogP | 2.68 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |