C34H30O6S — CID 72696551
[(2R,3S,3aR,6aS)-3-(4-methylphenyl)sulfonyl-5-phenyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]-phenylmethanone (PubChem CID 72696551) has the molecular formula C34H30O6S and a molecular weight of 566.68 g/mol. Its IUPAC name is [(2R,3S,3aR,6aS)-3-(4-methylphenyl)sulfonyl-5-phenyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]-phenylmethanone.
| Compound Name | [(2R,3S,3aR,6aS)-3-(4-methylphenyl)sulfonyl-5-phenyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 72696551 |
| Molecular Formula | C34H30O6S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | [(2R,3S,3aR,6aS)-3-(4-methylphenyl)sulfonyl-5-phenyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]-phenylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2[C@@H]3C(C(=O)c4ccccc4)=C(c4ccccc4)O[C@@H]3O[C@@H]2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H30O6S/c1-23-17-19-27(20-18-23)41(36,37)33-28(22-38-21-24-11-5-2-6-12-24)39-34-30(33)29(31(35)25-13-7-3-8-14-25)32(40-34)26-15-9-4-10-16-26/h2-20,28,30,33-34H,21-22H2,1H3/t28-,30+,33-,34+/m1/s1 |
| InChIKey | IDDTWXPCOVLAGH-LWNHUZNUSA-N |
| XLogP | 6.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |