C33H36O8S — CID 123901427
[2-benzoyloxy-3-[3-methoxy-4-[(4-methylphenyl)sulfonylmethyl]-5-prop-2-enyloxolan-2-yl]propyl] benzoate (PubChem CID 123901427) has the molecular formula C33H36O8S and a molecular weight of 592.71 g/mol. Its IUPAC name is [2-benzoyloxy-3-[3-methoxy-4-[(4-methylphenyl)sulfonylmethyl]-5-prop-2-enyloxolan-2-yl]propyl] benzoate.
| Compound Name | [2-benzoyloxy-3-[3-methoxy-4-[(4-methylphenyl)sulfonylmethyl]-5-prop-2-enyloxolan-2-yl]propyl] benzoate |
|---|---|
| PubChem CID | 123901427 |
| Molecular Formula | C33H36O8S |
| Molecular Weight | 592.71 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | [2-benzoyloxy-3-[3-methoxy-4-[(4-methylphenyl)sulfonylmethyl]-5-prop-2-enyloxolan-2-yl]propyl] benzoate |
| SMILES | C=CCC1OC(CC(COC(=O)c2ccccc2)OC(=O)c2ccccc2)C(OC)C1CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H36O8S/c1-4-11-29-28(22-42(36,37)27-18-16-23(2)17-19-27)31(38-3)30(41-29)20-26(40-33(35)25-14-9-6-10-15-25)21-39-32(34)24-12-7-5-8-13-24/h4-10,12-19,26,28-31H,1,11,20-22H2,2-3H3 |
| InChIKey | MFNWUFHZXVFGJU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.71 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|