C28H32F2O6S — CID 163359673
[(E)-8-(benzenesulfonyl)-1-(4,4-difluorocyclohexanecarbonyl)oxyoct-6-en-4-yl] benzoate (PubChem CID 163359673) has the molecular formula C28H32F2O6S and a molecular weight of 534.62 g/mol. Its IUPAC name is [(E)-8-(benzenesulfonyl)-1-(4,4-difluorocyclohexanecarbonyl)oxyoct-6-en-4-yl] benzoate.
| Compound Name | [(E)-8-(benzenesulfonyl)-1-(4,4-difluorocyclohexanecarbonyl)oxyoct-6-en-4-yl] benzoate |
|---|---|
| PubChem CID | 163359673 |
| Molecular Formula | C28H32F2O6S |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | [(E)-8-(benzenesulfonyl)-1-(4,4-difluorocyclohexanecarbonyl)oxyoct-6-en-4-yl] benzoate |
| SMILES | O=C(OC(C/C=C/CS(=O)(=O)c1ccccc1)CCCOC(=O)C1CCC(F)(F)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H32F2O6S/c29-28(30)18-16-23(17-19-28)26(31)35-20-9-13-24(36-27(32)22-10-3-1-4-11-22)12-7-8-21-37(33,34)25-14-5-2-6-15-25/h1-8,10-11,14-15,23-24H,9,12-13,16-21H2/b8-7+ |
| InChIKey | WQHHEXJKXSHCDN-BQYQJAHWSA-N |
| XLogP | 5.78 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|