C25H30O7S — CID 72696958
3-[(2R,3S,5R)-2-methoxy-4-(4-methylphenyl)sulfonyl-5-(phenylmethoxymethyl)oxolan-3-yl]pentane-2,4-dione (PubChem CID 72696958) has the molecular formula C25H30O7S and a molecular weight of 474.58 g/mol. Its IUPAC name is 3-[(2R,3S,5R)-2-methoxy-4-(4-methylphenyl)sulfonyl-5-(phenylmethoxymethyl)oxolan-3-yl]pentane-2,4-dione.
| Compound Name | 3-[(2R,3S,5R)-2-methoxy-4-(4-methylphenyl)sulfonyl-5-(phenylmethoxymethyl)oxolan-3-yl]pentane-2,4-dione |
|---|---|
| PubChem CID | 72696958 |
| Molecular Formula | C25H30O7S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 3-[(2R,3S,5R)-2-methoxy-4-(4-methylphenyl)sulfonyl-5-(phenylmethoxymethyl)oxolan-3-yl]pentane-2,4-dione |
| SMILES | CO[C@@H]1O[C@H](COCc2ccccc2)C(S(=O)(=O)c2ccc(C)cc2)[C@H]1C(C(C)=O)C(C)=O |
| InChI | InChI=1S/C25H30O7S/c1-16-10-12-20(13-11-16)33(28,29)24-21(15-31-14-19-8-6-5-7-9-19)32-25(30-4)23(24)22(17(2)26)18(3)27/h5-13,21-25H,14-15H2,1-4H3/t21-,23-,24?,25-/m1/s1 |
| InChIKey | YSGUDFDLRRRKCI-MLBCWQIMSA-N |
| XLogP | 3.14 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|