C18H22O6S — CID 72697241
3-[(1R,3R,4S,5S)-3-methoxy-5-(4-methylphenyl)sulfonyl-2-oxabicyclo[3.1.0]hexan-4-yl]pentane-2,4-dione (PubChem CID 72697241) has the molecular formula C18H22O6S and a molecular weight of 366.44 g/mol. Its IUPAC name is 3-[(1R,3R,4S,5S)-3-methoxy-5-(4-methylphenyl)sulfonyl-2-oxabicyclo[3.1.0]hexan-4-yl]pentane-2,4-dione.
| Compound Name | 3-[(1R,3R,4S,5S)-3-methoxy-5-(4-methylphenyl)sulfonyl-2-oxabicyclo[3.1.0]hexan-4-yl]pentane-2,4-dione |
|---|---|
| PubChem CID | 72697241 |
| Molecular Formula | C18H22O6S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 3-[(1R,3R,4S,5S)-3-methoxy-5-(4-methylphenyl)sulfonyl-2-oxabicyclo[3.1.0]hexan-4-yl]pentane-2,4-dione |
| SMILES | CO[C@@H]1O[C@@H]2C[C@]2(S(=O)(=O)c2ccc(C)cc2)[C@H]1C(C(C)=O)C(C)=O |
| InChI | InChI=1S/C18H22O6S/c1-10-5-7-13(8-6-10)25(21,22)18-9-14(18)24-17(23-4)16(18)15(11(2)19)12(3)20/h5-8,14-17H,9H2,1-4H3/t14-,16+,17-,18-/m1/s1 |
| InChIKey | MAIWTHVUPWNDBK-BZZMCLGOSA-N |
| XLogP | 1.69 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|