C20H26O8S — CID 102363055
ethyl 2-[(1S,3S,4R,7R,8S)-3-methoxy-8-(4-methylphenyl)sulfonyl-2,5-dioxabicyclo[2.2.2]octan-7-yl]-3-oxobutanoate (PubChem CID 102363055) has the molecular formula C20H26O8S and a molecular weight of 426.49 g/mol. Its IUPAC name is ethyl 2-[(1S,3S,4R,7R,8S)-3-methoxy-8-(4-methylphenyl)sulfonyl-2,5-dioxabicyclo[2.2.2]octan-7-yl]-3-oxobutanoate.
| Compound Name | ethyl 2-[(1S,3S,4R,7R,8S)-3-methoxy-8-(4-methylphenyl)sulfonyl-2,5-dioxabicyclo[2.2.2]octan-7-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 102363055 |
| Molecular Formula | C20H26O8S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | ethyl 2-[(1S,3S,4R,7R,8S)-3-methoxy-8-(4-methylphenyl)sulfonyl-2,5-dioxabicyclo[2.2.2]octan-7-yl]-3-oxobutanoate |
| SMILES | CCOC(=O)C(C(C)=O)[C@H]1[C@H](S(=O)(=O)c2ccc(C)cc2)[C@@H]2OC[C@H]1O[C@@H]2OC |
| InChI | InChI=1S/C20H26O8S/c1-5-26-19(22)15(12(3)21)16-14-10-27-17(20(25-4)28-14)18(16)29(23,24)13-8-6-11(2)7-9-13/h6-9,14-18,20H,5,10H2,1-4H3/t14-,15?,16+,17+,18+,20+/m1/s1 |
| InChIKey | KXCWOGJYYWGDMA-IAZCVYCWSA-N |
| XLogP | 1.29 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|