C16H22O7S — CID 11428310
methyl (2R,3S)-3-(diethoxymethyl)-2-(4-methylphenyl)sulfonyloxirane-2-carboxylate (PubChem CID 11428310) has the molecular formula C16H22O7S and a molecular weight of 358.41 g/mol. Its IUPAC name is methyl (2R,3S)-3-(diethoxymethyl)-2-(4-methylphenyl)sulfonyloxirane-2-carboxylate.
| Compound Name | methyl (2R,3S)-3-(diethoxymethyl)-2-(4-methylphenyl)sulfonyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 11428310 |
| Molecular Formula | C16H22O7S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | methyl (2R,3S)-3-(diethoxymethyl)-2-(4-methylphenyl)sulfonyloxirane-2-carboxylate |
| SMILES | CCOC(OCC)[C@@H]1O[C@@]1(C(=O)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22O7S/c1-5-21-14(22-6-2)13-16(23-13,15(17)20-4)24(18,19)12-9-7-11(3)8-10-12/h7-10,13-14H,5-6H2,1-4H3/t13-,16+/m0/s1 |
| InChIKey | RRXAEAJFUIBBGQ-XJKSGUPXSA-N |
| XLogP | 1.44 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|