C13H15IO4S — CID 150761246
methyl 2-iodo-1-methyl-2-(4-methylphenyl)sulfonylcyclopropane-1-carboxylate (PubChem CID 150761246) has the molecular formula C13H15IO4S and a molecular weight of 394.23 g/mol. Its IUPAC name is methyl 2-iodo-1-methyl-2-(4-methylphenyl)sulfonylcyclopropane-1-carboxylate.
| Compound Name | methyl 2-iodo-1-methyl-2-(4-methylphenyl)sulfonylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 150761246 |
| Molecular Formula | C13H15IO4S |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | methyl 2-iodo-1-methyl-2-(4-methylphenyl)sulfonylcyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(C)CC1(I)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H15IO4S/c1-9-4-6-10(7-5-9)19(16,17)13(14)8-12(13,2)11(15)18-3/h4-7H,8H2,1-3H3 |
| InChIKey | JXWLMQPMIZHTCL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|