C20H25NO6S — CID 73438653
methyl (1R,7S,10R)-1,7,10-trimethyl-4-(4-methylphenyl)sulfonyl-8,9-dioxa-4-azatricyclo[5.2.2.02,6]undec-2(6)-ene-10-carboxylate (PubChem CID 73438653) has the molecular formula C20H25NO6S and a molecular weight of 407.49 g/mol. Its IUPAC name is methyl (1R,7S,10R)-1,7,10-trimethyl-4-(4-methylphenyl)sulfonyl-8,9-dioxa-4-azatricyclo[5.2.2.02,6]undec-2(6)-ene-10-carboxylate.
| Compound Name | methyl (1R,7S,10R)-1,7,10-trimethyl-4-(4-methylphenyl)sulfonyl-8,9-dioxa-4-azatricyclo[5.2.2.02,6]undec-2(6)-ene-10-carboxylate |
|---|---|
| PubChem CID | 73438653 |
| Molecular Formula | C20H25NO6S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | methyl (1R,7S,10R)-1,7,10-trimethyl-4-(4-methylphenyl)sulfonyl-8,9-dioxa-4-azatricyclo[5.2.2.02,6]undec-2(6)-ene-10-carboxylate |
| SMILES | COC(=O)[C@]1(C)C[C@]2(C)OO[C@]1(C)C1=C2CN(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C20H25NO6S/c1-13-6-8-14(9-7-13)28(23,24)21-10-15-16(11-21)20(4)18(2,17(22)25-5)12-19(15,3)26-27-20/h6-9H,10-12H2,1-5H3/t18-,19-,20+/m0/s1 |
| InChIKey | ATYBPKWHURRXMO-SLFFLAALSA-N |
| XLogP | 2.36 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|