C13H18N2O4S — CID 95839416
(2S)-2-methyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide (PubChem CID 95839416) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is (2S)-2-methyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide.
| Compound Name | (2S)-2-methyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 95839416 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (2S)-2-methyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCO[C@](C)(C(N)=O)C2)cc1 |
| InChI | InChI=1S/C13H18N2O4S/c1-10-3-5-11(6-4-10)20(17,18)15-7-8-19-13(2,9-15)12(14)16/h3-6H,7-9H2,1-2H3,(H2,14,16)/t13-/m0/s1 |
| InChIKey | XMGNXOMLWOMLEY-ZDUSSCGKSA-N |
| XLogP | 0.26 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |