About (2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide
(2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide (PubChem CID 95839418) has the molecular formula C14H20N2O4S
and a molecular weight of 312.39 g/mol. Its IUPAC name is (2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide |
| PubChem CID | 95839418 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide |
| SMILES | CNC(=O)[C@]1(C)CN(S(=O)(=O)c2ccc(C)cc2)CCO1 |
| InChI | InChI=1S/C14H20N2O4S/c1-11-4-6-12(7-5-11)21(18,19)16-8-9-20-14(2,10-16)13(17)15-3/h4-7H,8-10H2,1-3H3,(H,15,17)/t14-/m0/s1 |
| InChIKey | DIPUALLPJHBHMD-AWEZNQCLSA-N |
| XLogP | 0.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide?
The IUPAC name of (2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide (CID 95839418) is (2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide.
What is the SMILES notation for (2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide?
The canonical SMILES for (2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide is CNC(=O)[C@]1(C)CN(S(=O)(=O)c2ccc(C)cc2)CCO1.
What is the InChIKey of (2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide?
The InChIKey is DIPUALLPJHBHMD-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H20N2O4S/c1-11-4-6-12(7-5-11)21(18,19)16-8-9-20-14(2,10-16)13(17)15-3/h4-7H,8-10H2,1-3H3,(H,15,17)/t14-/m0/s1.
What are the key properties of (2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide?
(2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide has a molecular weight of 312.39 g/mol, XLogP of 0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,2-dimethyl-4-(4-methylphenyl)sulfonylmorpholine-2-carboxamide is sourced from PubChem (CID 95839418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).